C15H15Cl2NO3 — CID 81368501
3-cyclopropyl-3-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 81368501) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.20 g/mol. Its IUPAC name is 3-cyclopropyl-3-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 81368501 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-cyclopropyl-3-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)/C=C/c1cc(Cl)cc(Cl)c1)C1CC1 |
| InChI | InChI=1S/C15H15Cl2NO3/c16-11-5-9(6-12(17)7-11)1-4-14(19)18-13(8-15(20)21)10-2-3-10/h1,4-7,10,13H,2-3,8H2,(H,18,19)(H,20,21)/b4-1+ |
| InChIKey | ZLPIEVZTOZENMP-DAFODLJHSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|