C19H30N2 — CID 81369214
1-(3-methylbut-2-enyl)-N-[(1R)-1-(3-methylphenyl)ethyl]piperidin-4-amine (PubChem CID 81369214) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-N-[(1R)-1-(3-methylphenyl)ethyl]piperidin-4-amine.
| Compound Name | 1-(3-methylbut-2-enyl)-N-[(1R)-1-(3-methylphenyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 81369214 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-N-[(1R)-1-(3-methylphenyl)ethyl]piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(N[C@H](C)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C19H30N2/c1-15(2)8-11-21-12-9-19(10-13-21)20-17(4)18-7-5-6-16(3)14-18/h5-8,14,17,19-20H,9-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | RZLAUYADEFKWLZ-QGZVFWFLSA-N |
| XLogP | 4.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|