C17H18Cl2FN — CID 81369974
(1S)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(3-methylphenyl)ethanamine (PubChem CID 81369974) has the molecular formula C17H18Cl2FN and a molecular weight of 326.24 g/mol. Its IUPAC name is (1S)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(3-methylphenyl)ethanamine.
| Compound Name | (1S)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 81369974 |
| Molecular Formula | C17H18Cl2FN |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (1S)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc([C@H](C)NC(C)c2cc(F)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H18Cl2FN/c1-10-5-4-6-13(7-10)11(2)21-12(3)14-8-17(20)16(19)9-15(14)18/h4-9,11-12,21H,1-3H3/t11-,12?/m0/s1 |
| InChIKey | BKCNOSKDWBEHHE-PXYINDEMSA-N |
| XLogP | 5.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|