C12H15NO3S — CID 81370089
2,2-dimethyl-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]propanoic acid (PubChem CID 81370089) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 81370089 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2,2-dimethyl-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]propanoic acid |
| SMILES | CC(C)(CNC(=O)/C=C/c1cccs1)C(=O)O |
| InChI | InChI=1S/C12H15NO3S/c1-12(2,11(15)16)8-13-10(14)6-5-9-4-3-7-17-9/h3-7H,8H2,1-2H3,(H,13,14)(H,15,16)/b6-5+ |
| InChIKey | REWZLUYGQPNWLA-AATRIKPKSA-N |
| XLogP | 1.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|