C17H24N2 — CID 81375246
(1S)-1-(2-methylphenyl)-N-[(1-propylpyrrol-2-yl)methyl]ethanamine (PubChem CID 81375246) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (1S)-1-(2-methylphenyl)-N-[(1-propylpyrrol-2-yl)methyl]ethanamine.
| Compound Name | (1S)-1-(2-methylphenyl)-N-[(1-propylpyrrol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81375246 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (1S)-1-(2-methylphenyl)-N-[(1-propylpyrrol-2-yl)methyl]ethanamine |
| SMILES | CCCn1cccc1CN[C@@H](C)c1ccccc1C |
| InChI | InChI=1S/C17H24N2/c1-4-11-19-12-7-9-16(19)13-18-15(3)17-10-6-5-8-14(17)2/h5-10,12,15,18H,4,11,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | DBFZKZKSFZHWCA-HNNXBMFYSA-N |
| XLogP | 4.06 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |