C18H23NO — CID 81376233
N-[(1S)-1-(3-methoxyphenyl)ethyl]-1-(4-methylphenyl)ethanamine (PubChem CID 81376233) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is N-[(1S)-1-(3-methoxyphenyl)ethyl]-1-(4-methylphenyl)ethanamine.
| Compound Name | N-[(1S)-1-(3-methoxyphenyl)ethyl]-1-(4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 81376233 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-[(1S)-1-(3-methoxyphenyl)ethyl]-1-(4-methylphenyl)ethanamine |
| SMILES | COc1cccc([C@H](C)NC(C)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H23NO/c1-13-8-10-16(11-9-13)14(2)19-15(3)17-6-5-7-18(12-17)20-4/h5-12,14-15,19H,1-4H3/t14?,15-/m0/s1 |
| InChIKey | RQEVDYVMQXYSOB-LOACHALJSA-N |
| XLogP | 4.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |