C14H21NO2 — CID 81376792
(1R)-1-(3-methoxyphenyl)-N-(oxolan-3-ylmethyl)ethanamine (PubChem CID 81376792) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (1R)-1-(3-methoxyphenyl)-N-(oxolan-3-ylmethyl)ethanamine.
| Compound Name | (1R)-1-(3-methoxyphenyl)-N-(oxolan-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 81376792 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (1R)-1-(3-methoxyphenyl)-N-(oxolan-3-ylmethyl)ethanamine |
| SMILES | COc1cccc([C@@H](C)NCC2CCOC2)c1 |
| InChI | InChI=1S/C14H21NO2/c1-11(15-9-12-6-7-17-10-12)13-4-3-5-14(8-13)16-2/h3-5,8,11-12,15H,6-7,9-10H2,1-2H3/t11-,12?/m1/s1 |
| InChIKey | KYRJQFHYMYFZEN-JHJMLUEUSA-N |
| XLogP | 2.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |