C17H18BrN3 — CID 81378061
(1R)-1-(2-bromophenyl)-N-[(1-methylindazol-3-yl)methyl]ethanamine (PubChem CID 81378061) has the molecular formula C17H18BrN3 and a molecular weight of 344.26 g/mol. Its IUPAC name is (1R)-1-(2-bromophenyl)-N-[(1-methylindazol-3-yl)methyl]ethanamine.
| Compound Name | (1R)-1-(2-bromophenyl)-N-[(1-methylindazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81378061 |
| Molecular Formula | C17H18BrN3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (1R)-1-(2-bromophenyl)-N-[(1-methylindazol-3-yl)methyl]ethanamine |
| SMILES | C[C@@H](NCc1nn(C)c2ccccc12)c1ccccc1Br |
| InChI | InChI=1S/C17H18BrN3/c1-12(13-7-3-5-9-15(13)18)19-11-16-14-8-4-6-10-17(14)21(2)20-16/h3-10,12,19H,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | JEWPZNJEGUHDGL-GFCCVEGCSA-N |
| XLogP | 4.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |