C16H18BrNO2 — CID 81378471
2-[1-[[(1R)-1-(2-bromophenyl)ethyl]amino]ethyl]benzene-1,4-diol (PubChem CID 81378471) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-[1-[[(1R)-1-(2-bromophenyl)ethyl]amino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[[(1R)-1-(2-bromophenyl)ethyl]amino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 81378471 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-[1-[[(1R)-1-(2-bromophenyl)ethyl]amino]ethyl]benzene-1,4-diol |
| SMILES | CC(N[C@H](C)c1ccccc1Br)c1cc(O)ccc1O |
| InChI | InChI=1S/C16H18BrNO2/c1-10(13-5-3-4-6-15(13)17)18-11(2)14-9-12(19)7-8-16(14)20/h3-11,18-20H,1-2H3/t10-,11?/m1/s1 |
| InChIKey | MEFVPTWXKMYIKW-NFJWQWPMSA-N |
| XLogP | 4.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|