About 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol
4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol (PubChem CID 81378841) has the molecular formula C15H14BrF2NO
and a molecular weight of 342.18 g/mol. Its IUPAC name is 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol.
Molecular Properties
| Compound Name | 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol |
| PubChem CID | 81378841 |
| Molecular Formula | C15H14BrF2NO |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol |
| SMILES | C[C@@H](NCc1cc(F)c(O)c(F)c1)c1ccccc1Br |
| InChI | InChI=1S/C15H14BrF2NO/c1-9(11-4-2-3-5-12(11)16)19-8-10-6-13(17)15(20)14(18)7-10/h2-7,9,19-20H,8H2,1H3/t9-/m1/s1 |
| InChIKey | JIDYARILZCWXRJ-SECBINFHSA-N |
| XLogP | 4.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol?
The IUPAC name of 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol (CID 81378841) is 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol.
What is the SMILES notation for 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol?
The canonical SMILES for 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol is C[C@@H](NCc1cc(F)c(O)c(F)c1)c1ccccc1Br.
What is the InChIKey of 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol?
The InChIKey is JIDYARILZCWXRJ-SECBINFHSA-N. The full InChI is InChI=1S/C15H14BrF2NO/c1-9(11-4-2-3-5-12(11)16)19-8-10-6-13(17)15(20)14(18)7-10/h2-7,9,19-20H,8H2,1H3/t9-/m1/s1.
What are the key properties of 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol?
4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol has a molecular weight of 342.18 g/mol, XLogP of 4.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(1R)-1-(2-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol is sourced from PubChem (CID 81378841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).