C14H22BrNO2 — CID 81381416
1-[[(1S)-1-(3-bromophenyl)ethyl]amino]-3-propan-2-yloxypropan-2-ol (PubChem CID 81381416) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is 1-[[(1S)-1-(3-bromophenyl)ethyl]amino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[[(1S)-1-(3-bromophenyl)ethyl]amino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 81381416 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-[[(1S)-1-(3-bromophenyl)ethyl]amino]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)CN[C@@H](C)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H22BrNO2/c1-10(2)18-9-14(17)8-16-11(3)12-5-4-6-13(15)7-12/h4-7,10-11,14,16-17H,8-9H2,1-3H3/t11-,14?/m0/s1 |
| InChIKey | JJWPHUQPPQLXRM-ZSOXZCCMSA-N |
| XLogP | 2.89 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |