C16H20BrN — CID 81382032
(1R)-N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-(3-bromophenyl)ethanamine (PubChem CID 81382032) has the molecular formula C16H20BrN and a molecular weight of 306.25 g/mol. Its IUPAC name is (1R)-N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-(3-bromophenyl)ethanamine.
| Compound Name | (1R)-N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-(3-bromophenyl)ethanamine |
|---|---|
| PubChem CID | 81382032 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (1R)-N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-(3-bromophenyl)ethanamine |
| SMILES | C[C@@H](NCC1CC2C=CC1C2)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H20BrN/c1-11(13-3-2-4-16(17)9-13)18-10-15-8-12-5-6-14(15)7-12/h2-6,9,11-12,14-15,18H,7-8,10H2,1H3/t11-,12?,14?,15?/m1/s1 |
| InChIKey | JEZNSFRFBQSOGZ-VSROEWIGSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|