C16H16BrF2NO — CID 81382557
2-[[(1R)-1-(3-bromophenyl)ethyl]amino]-1-(2,4-difluorophenyl)ethanol (PubChem CID 81382557) has the molecular formula C16H16BrF2NO and a molecular weight of 356.21 g/mol. Its IUPAC name is 2-[[(1R)-1-(3-bromophenyl)ethyl]amino]-1-(2,4-difluorophenyl)ethanol.
| Compound Name | 2-[[(1R)-1-(3-bromophenyl)ethyl]amino]-1-(2,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 81382557 |
| Molecular Formula | C16H16BrF2NO |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-[[(1R)-1-(3-bromophenyl)ethyl]amino]-1-(2,4-difluorophenyl)ethanol |
| SMILES | C[C@@H](NCC(O)c1ccc(F)cc1F)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H16BrF2NO/c1-10(11-3-2-4-12(17)7-11)20-9-16(21)14-6-5-13(18)8-15(14)19/h2-8,10,16,20-21H,9H2,1H3/t10-,16?/m1/s1 |
| InChIKey | GWCJHORNXPZNBY-HQNRFAHOSA-N |
| XLogP | 4.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |