C13H20BrN — CID 81383492
N-[(1S)-1-(2-bromophenyl)ethyl]-2-methylbutan-1-amine (PubChem CID 81383492) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromophenyl)ethyl]-2-methylbutan-1-amine.
| Compound Name | N-[(1S)-1-(2-bromophenyl)ethyl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 81383492 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[(1S)-1-(2-bromophenyl)ethyl]-2-methylbutan-1-amine |
| SMILES | CCC(C)CN[C@@H](C)c1ccccc1Br |
| InChI | InChI=1S/C13H20BrN/c1-4-10(2)9-15-11(3)12-7-5-6-8-13(12)14/h5-8,10-11,15H,4,9H2,1-3H3/t10?,11-/m0/s1 |
| InChIKey | VENFDWPFCRBEPI-DTIOYNMSSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |