C18H34N2 — CID 81384136
N-[(1R)-1-cyclohexylethyl]-2-piperidin-2-ylcyclopentan-1-amine (PubChem CID 81384136) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexylethyl]-2-piperidin-2-ylcyclopentan-1-amine.
| Compound Name | N-[(1R)-1-cyclohexylethyl]-2-piperidin-2-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 81384136 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | N-[(1R)-1-cyclohexylethyl]-2-piperidin-2-ylcyclopentan-1-amine |
| SMILES | C[C@@H](NC1CCCC1C1CCCCN1)C1CCCCC1 |
| InChI | InChI=1S/C18H34N2/c1-14(15-8-3-2-4-9-15)20-18-12-7-10-16(18)17-11-5-6-13-19-17/h14-20H,2-13H2,1H3/t14-,16?,17?,18?/m1/s1 |
| InChIKey | YHNNJBVZYISJMF-UWIAJVCOSA-N |
| XLogP | 3.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |