C11H20F3N — CID 81384504
N-[(1S)-1-cyclohexylethyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 81384504) has the molecular formula C11H20F3N and a molecular weight of 223.28 g/mol. Its IUPAC name is N-[(1S)-1-cyclohexylethyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(1S)-1-cyclohexylethyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 81384504 |
| Molecular Formula | C11H20F3N |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | N-[(1S)-1-cyclohexylethyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | C[C@H](NCCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H20F3N/c1-9(10-5-3-2-4-6-10)15-8-7-11(12,13)14/h9-10,15H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | PQTMUXBBAZKVHT-VIFPVBQESA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |