C14H28N2 — CID 81385078
4-N-[(1R)-1-cyclohexylethyl]cyclohexane-1,4-diamine (PubChem CID 81385078) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-N-[(1R)-1-cyclohexylethyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(1R)-1-cyclohexylethyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 81385078 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 4-N-[(1R)-1-cyclohexylethyl]cyclohexane-1,4-diamine |
| SMILES | C[C@@H](NC1CCC(N)CC1)C1CCCCC1 |
| InChI | InChI=1S/C14H28N2/c1-11(12-5-3-2-4-6-12)16-14-9-7-13(15)8-10-14/h11-14,16H,2-10,15H2,1H3/t11-,13?,14?/m1/s1 |
| InChIKey | XCIDPLLMIRPUAD-LMWSTFAQSA-N |
| XLogP | 2.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |