About N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine
N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine (PubChem CID 81385216) has the molecular formula C10H18F3N
and a molecular weight of 209.25 g/mol. Its IUPAC name is N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine |
| PubChem CID | 81385216 |
| Molecular Formula | C10H18F3N |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine |
| SMILES | C[C@H](NCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H18F3N/c1-8(14-7-10(11,12)13)9-5-3-2-4-6-9/h8-9,14H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | RBMCLQNJUANIEM-QMMMGPOBSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine?
The IUPAC name of N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine (CID 81385216) is N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine.
What is the SMILES notation for N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine?
The canonical SMILES for N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine is C[C@H](NCC(F)(F)F)C1CCCCC1.
What is the InChIKey of N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine?
The InChIKey is RBMCLQNJUANIEM-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H18F3N/c1-8(14-7-10(11,12)13)9-5-3-2-4-6-9/h8-9,14H,2-7H2,1H3/t8-/m0/s1.
What are the key properties of N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine?
N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine has a molecular weight of 209.25 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-cyclohexylethyl]-2,2,2-trifluoroethanamine is sourced from PubChem (CID 81385216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).