C16H31N — CID 81385364
N-[(1R)-1-cyclohexylethyl]-2,4-dimethylcyclohexan-1-amine (PubChem CID 81385364) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexylethyl]-2,4-dimethylcyclohexan-1-amine.
| Compound Name | N-[(1R)-1-cyclohexylethyl]-2,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 81385364 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | N-[(1R)-1-cyclohexylethyl]-2,4-dimethylcyclohexan-1-amine |
| SMILES | CC1CCC(N[C@H](C)C2CCCCC2)C(C)C1 |
| InChI | InChI=1S/C16H31N/c1-12-9-10-16(13(2)11-12)17-14(3)15-7-5-4-6-8-15/h12-17H,4-11H2,1-3H3/t12?,13?,14-,16?/m1/s1 |
| InChIKey | HWAOQBHAUDYGGD-SWAPUOLTSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |