C16H29N — CID 81385495
(1R)-N-(2-bicyclo[2.2.1]heptanylmethyl)-1-cyclohexylethanamine (PubChem CID 81385495) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (1R)-N-(2-bicyclo[2.2.1]heptanylmethyl)-1-cyclohexylethanamine.
| Compound Name | (1R)-N-(2-bicyclo[2.2.1]heptanylmethyl)-1-cyclohexylethanamine |
|---|---|
| PubChem CID | 81385495 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (1R)-N-(2-bicyclo[2.2.1]heptanylmethyl)-1-cyclohexylethanamine |
| SMILES | C[C@@H](NCC1CC2CCC1C2)C1CCCCC1 |
| InChI | InChI=1S/C16H29N/c1-12(14-5-3-2-4-6-14)17-11-16-10-13-7-8-15(16)9-13/h12-17H,2-11H2,1H3/t12-,13?,15?,16?/m1/s1 |
| InChIKey | FGQLDGOLWDOAEQ-KHZFOJANSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |