C17H25NO2S — CID 81390967
N-[(1S)-1-cyclohexylethyl]-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 81390967) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[(1S)-1-cyclohexylethyl]-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-[(1S)-1-cyclohexylethyl]-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 81390967 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[(1S)-1-cyclohexylethyl]-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | C[C@H](NC1CCS(=O)(=O)c2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C17H25NO2S/c1-13(14-7-3-2-4-8-14)18-16-11-12-21(19,20)17-10-6-5-9-15(16)17/h5-6,9-10,13-14,16,18H,2-4,7-8,11-12H2,1H3/t13-,16?/m0/s1 |
| InChIKey | AGTRSQRKRVAANG-KNVGNIICSA-N |
| XLogP | 3.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |