C17H25F2NO — CID 81390973
(1S)-1-cyclohexyl-N-[1-[2-(difluoromethoxy)phenyl]ethyl]ethanamine (PubChem CID 81390973) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-N-[1-[2-(difluoromethoxy)phenyl]ethyl]ethanamine.
| Compound Name | (1S)-1-cyclohexyl-N-[1-[2-(difluoromethoxy)phenyl]ethyl]ethanamine |
|---|---|
| PubChem CID | 81390973 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (1S)-1-cyclohexyl-N-[1-[2-(difluoromethoxy)phenyl]ethyl]ethanamine |
| SMILES | CC(N[C@@H](C)C1CCCCC1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C17H25F2NO/c1-12(14-8-4-3-5-9-14)20-13(2)15-10-6-7-11-16(15)21-17(18)19/h6-7,10-14,17,20H,3-5,8-9H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | JYYLHZHPYYKVKF-UEWDXFNNSA-N |
| XLogP | 4.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |