C17H26BrNO — CID 81393437
1-(3-bromophenyl)-2-[[(1R)-1-cycloheptylethyl]amino]ethanol (PubChem CID 81393437) has the molecular formula C17H26BrNO and a molecular weight of 340.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-[[(1R)-1-cycloheptylethyl]amino]ethanol.
| Compound Name | 1-(3-bromophenyl)-2-[[(1R)-1-cycloheptylethyl]amino]ethanol |
|---|---|
| PubChem CID | 81393437 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-(3-bromophenyl)-2-[[(1R)-1-cycloheptylethyl]amino]ethanol |
| SMILES | C[C@@H](NCC(O)c1cccc(Br)c1)C1CCCCCC1 |
| InChI | InChI=1S/C17H26BrNO/c1-13(14-7-4-2-3-5-8-14)19-12-17(20)15-9-6-10-16(18)11-15/h6,9-11,13-14,17,19-20H,2-5,7-8,12H2,1H3/t13-,17?/m1/s1 |
| InChIKey | KGWOXAAPMNCYJW-FWJOYPJLSA-N |
| XLogP | 4.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |