C13H23N3O — CID 81393576
N-(cyanomethyl)-2-[[(1R)-1-cycloheptylethyl]amino]acetamide (PubChem CID 81393576) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[[(1R)-1-cycloheptylethyl]amino]acetamide.
| Compound Name | N-(cyanomethyl)-2-[[(1R)-1-cycloheptylethyl]amino]acetamide |
|---|---|
| PubChem CID | 81393576 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N-(cyanomethyl)-2-[[(1R)-1-cycloheptylethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)NCC#N)C1CCCCCC1 |
| InChI | InChI=1S/C13H23N3O/c1-11(12-6-4-2-3-5-7-12)16-10-13(17)15-9-8-14/h11-12,16H,2-7,9-10H2,1H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | VABHEYRGDMZKOK-LLVKDONJSA-N |
| XLogP | 1.57 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|