C15H21N3O3 — CID 81393685
1-(2-amino-6-ethoxybenzoyl)piperidine-4-carboxamide (PubChem CID 81393685) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-(2-amino-6-ethoxybenzoyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-amino-6-ethoxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 81393685 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-(2-amino-6-ethoxybenzoyl)piperidine-4-carboxamide |
| SMILES | CCOc1cccc(N)c1C(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-2-21-12-5-3-4-11(16)13(12)15(20)18-8-6-10(7-9-18)14(17)19/h3-5,10H,2,6-9,16H2,1H3,(H2,17,19) |
| InChIKey | RPFFNZSEFUPQLL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|