C13H16F3NO4 — CID 81395083
3-(2,2,2-trifluoroethoxy)propyl 2-amino-6-methoxybenzoate (PubChem CID 81395083) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethoxy)propyl 2-amino-6-methoxybenzoate.
| Compound Name | 3-(2,2,2-trifluoroethoxy)propyl 2-amino-6-methoxybenzoate |
|---|---|
| PubChem CID | 81395083 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-(2,2,2-trifluoroethoxy)propyl 2-amino-6-methoxybenzoate |
| SMILES | COc1cccc(N)c1C(=O)OCCCOCC(F)(F)F |
| InChI | InChI=1S/C13H16F3NO4/c1-19-10-5-2-4-9(17)11(10)12(18)21-7-3-6-20-8-13(14,15)16/h2,4-5H,3,6-8,17H2,1H3 |
| InChIKey | SAGRVGCEEPBHGS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|