C16H25NOS — CID 81396655
N-[(1R)-1-(2-methoxyphenyl)ethyl]-4,4-dimethylthian-3-amine (PubChem CID 81396655) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is N-[(1R)-1-(2-methoxyphenyl)ethyl]-4,4-dimethylthian-3-amine.
| Compound Name | N-[(1R)-1-(2-methoxyphenyl)ethyl]-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 81396655 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-[(1R)-1-(2-methoxyphenyl)ethyl]-4,4-dimethylthian-3-amine |
| SMILES | COc1ccccc1[C@@H](C)NC1CSCCC1(C)C |
| InChI | InChI=1S/C16H25NOS/c1-12(13-7-5-6-8-14(13)18-4)17-15-11-19-10-9-16(15,2)3/h5-8,12,15,17H,9-11H2,1-4H3/t12-,15?/m1/s1 |
| InChIKey | KIOQXQLAWJEKCS-KEKZHRQWSA-N |
| XLogP | 3.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |