C12H16BrNO2 — CID 81396707
N-[(1R)-1-(2-bromophenyl)ethyl]-2-ethoxyacetamide (PubChem CID 81396707) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is N-[(1R)-1-(2-bromophenyl)ethyl]-2-ethoxyacetamide.
| Compound Name | N-[(1R)-1-(2-bromophenyl)ethyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 81396707 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-[(1R)-1-(2-bromophenyl)ethyl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)N[C@H](C)c1ccccc1Br |
| InChI | InChI=1S/C12H16BrNO2/c1-3-16-8-12(15)14-9(2)10-6-4-5-7-11(10)13/h4-7,9H,3,8H2,1-2H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | VZULIVCUPBEYKM-SECBINFHSA-N |
| XLogP | 2.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |