C10H15NOS — CID 81398144
N-[(1S)-1-thiophen-2-ylethyl]oxolan-3-amine (PubChem CID 81398144) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is N-[(1S)-1-thiophen-2-ylethyl]oxolan-3-amine.
| Compound Name | N-[(1S)-1-thiophen-2-ylethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 81398144 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-[(1S)-1-thiophen-2-ylethyl]oxolan-3-amine |
| SMILES | C[C@H](NC1CCOC1)c1cccs1 |
| InChI | InChI=1S/C10H15NOS/c1-8(10-3-2-6-13-10)11-9-4-5-12-7-9/h2-3,6,8-9,11H,4-5,7H2,1H3/t8-,9?/m0/s1 |
| InChIKey | YNOWCBLFFPRVSF-IENPIDJESA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |