About 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol
2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol (PubChem CID 81399724) has the molecular formula C16H24N4O
and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol |
| PubChem CID | 81399724 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C16H24N4O/c1-3-16(4-2,11-21)10-18-15-7-5-14(6-8-15)9-20-13-17-12-19-20/h5-8,12-13,18,21H,3-4,9-11H2,1-2H3 |
| InChIKey | RZDPQMIZZZGENG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol?
The IUPAC name of 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol (CID 81399724) is 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol.
What is the SMILES notation for 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol?
The canonical SMILES for 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol is CCC(CC)(CO)CNc1ccc(Cn2cncn2)cc1.
What is the InChIKey of 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol?
The InChIKey is RZDPQMIZZZGENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O/c1-3-16(4-2,11-21)10-18-15-7-5-14(6-8-15)9-20-13-17-12-19-20/h5-8,12-13,18,21H,3-4,9-11H2,1-2H3.
What are the key properties of 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol?
2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol has a molecular weight of 288.40 g/mol, XLogP of 2.54, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[[4-(1,2,4-triazol-1-ylmethyl)anilino]methyl]butan-1-ol is sourced from PubChem (CID 81399724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).