C13H18N2O3 — CID 81399842
3-methyl-5-oxo-5-[[(1S)-1-pyridin-2-ylethyl]amino]pentanoic acid (PubChem CID 81399842) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-methyl-5-oxo-5-[[(1S)-1-pyridin-2-ylethyl]amino]pentanoic acid.
| Compound Name | 3-methyl-5-oxo-5-[[(1S)-1-pyridin-2-ylethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 81399842 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-methyl-5-oxo-5-[[(1S)-1-pyridin-2-ylethyl]amino]pentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)N[C@@H](C)c1ccccn1 |
| InChI | InChI=1S/C13H18N2O3/c1-9(8-13(17)18)7-12(16)15-10(2)11-5-3-4-6-14-11/h3-6,9-10H,7-8H2,1-2H3,(H,15,16)(H,17,18)/t9?,10-/m0/s1 |
| InChIKey | YNPGNPWIYVDXHS-AXDSSHIGSA-N |
| XLogP | 1.76 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |