C12H18N2O3 — CID 81400402
N-[(1S)-1-(furan-2-yl)ethyl]-2-morpholin-2-ylacetamide (PubChem CID 81400402) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[(1S)-1-(furan-2-yl)ethyl]-2-morpholin-2-ylacetamide.
| Compound Name | N-[(1S)-1-(furan-2-yl)ethyl]-2-morpholin-2-ylacetamide |
|---|---|
| PubChem CID | 81400402 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-[(1S)-1-(furan-2-yl)ethyl]-2-morpholin-2-ylacetamide |
| SMILES | C[C@H](NC(=O)CC1CNCCO1)c1ccco1 |
| InChI | InChI=1S/C12H18N2O3/c1-9(11-3-2-5-17-11)14-12(15)7-10-8-13-4-6-16-10/h2-3,5,9-10,13H,4,6-8H2,1H3,(H,14,15)/t9-,10?/m0/s1 |
| InChIKey | LXBPOEFWAXSVLB-RGURZIINSA-N |
| XLogP | 0.84 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |