C10H16N2O2 — CID 81400789
3-amino-N-[(1S)-1-(furan-2-yl)ethyl]-2-methylpropanamide (PubChem CID 81400789) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-amino-N-[(1S)-1-(furan-2-yl)ethyl]-2-methylpropanamide.
| Compound Name | 3-amino-N-[(1S)-1-(furan-2-yl)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 81400789 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-amino-N-[(1S)-1-(furan-2-yl)ethyl]-2-methylpropanamide |
| SMILES | CC(CN)C(=O)N[C@@H](C)c1ccco1 |
| InChI | InChI=1S/C10H16N2O2/c1-7(6-11)10(13)12-8(2)9-4-3-5-14-9/h3-5,7-8H,6,11H2,1-2H3,(H,12,13)/t7?,8-/m0/s1 |
| InChIKey | LYHANOKWDUTKFQ-MQWKRIRWSA-N |
| XLogP | 1.05 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |