C15H16N2O2 — CID 81402485
3-[[(1S)-1-pyridin-2-ylethyl]amino]-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 81402485) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-[[(1S)-1-pyridin-2-ylethyl]amino]-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 3-[[(1S)-1-pyridin-2-ylethyl]amino]-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 81402485 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-[[(1S)-1-pyridin-2-ylethyl]amino]-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | C[C@H](NC1COc2cc(O)ccc21)c1ccccn1 |
| InChI | InChI=1S/C15H16N2O2/c1-10(13-4-2-3-7-16-13)17-14-9-19-15-8-11(18)5-6-12(14)15/h2-8,10,14,17-18H,9H2,1H3/t10-,14?/m0/s1 |
| InChIKey | WKNCJMNOYZMHTL-XLLULAGJSA-N |
| XLogP | 2.57 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |