C11H17NO2 — CID 81402561
N-[(1S)-1-(furan-2-yl)ethyl]oxan-3-amine (PubChem CID 81402561) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(1S)-1-(furan-2-yl)ethyl]oxan-3-amine.
| Compound Name | N-[(1S)-1-(furan-2-yl)ethyl]oxan-3-amine |
|---|---|
| PubChem CID | 81402561 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(1S)-1-(furan-2-yl)ethyl]oxan-3-amine |
| SMILES | C[C@H](NC1CCCOC1)c1ccco1 |
| InChI | InChI=1S/C11H17NO2/c1-9(11-5-3-7-14-11)12-10-4-2-6-13-8-10/h3,5,7,9-10,12H,2,4,6,8H2,1H3/t9-,10?/m0/s1 |
| InChIKey | GRJBFTOOTGDBAX-RGURZIINSA-N |
| XLogP | 2.11 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |