C15H25NO — CID 81403333
N-[(1R)-1-(furan-2-yl)ethyl]-3,3,5-trimethylcyclohexan-1-amine (PubChem CID 81403333) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-3,3,5-trimethylcyclohexan-1-amine.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-3,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 81403333 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-3,3,5-trimethylcyclohexan-1-amine |
| SMILES | CC1CC(N[C@H](C)c2ccco2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H25NO/c1-11-8-13(10-15(3,4)9-11)16-12(2)14-6-5-7-17-14/h5-7,11-13,16H,8-10H2,1-4H3/t11?,12-,13?/m1/s1 |
| InChIKey | ZAXCPBODKOFBAU-OTTFEQOBSA-N |
| XLogP | 4.14 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |