C12H18N2O — CID 81404067
(1S)-N-(oxolan-2-ylmethyl)-1-pyridin-3-ylethanamine (PubChem CID 81404067) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (1S)-N-(oxolan-2-ylmethyl)-1-pyridin-3-ylethanamine.
| Compound Name | (1S)-N-(oxolan-2-ylmethyl)-1-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 81404067 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1S)-N-(oxolan-2-ylmethyl)-1-pyridin-3-ylethanamine |
| SMILES | C[C@H](NCC1CCCO1)c1cccnc1 |
| InChI | InChI=1S/C12H18N2O/c1-10(11-4-2-6-13-8-11)14-9-12-5-3-7-15-12/h2,4,6,8,10,12,14H,3,5,7,9H2,1H3/t10-,12?/m0/s1 |
| InChIKey | DXTMTYJLEBWBAI-NUHJPDEHSA-N |
| XLogP | 1.91 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |