C16H24N2O — CID 81406128
3-ethoxy-N-[(1S)-1-pyridin-4-ylethyl]spiro[3.3]heptan-1-amine (PubChem CID 81406128) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-ethoxy-N-[(1S)-1-pyridin-4-ylethyl]spiro[3.3]heptan-1-amine.
| Compound Name | 3-ethoxy-N-[(1S)-1-pyridin-4-ylethyl]spiro[3.3]heptan-1-amine |
|---|---|
| PubChem CID | 81406128 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-ethoxy-N-[(1S)-1-pyridin-4-ylethyl]spiro[3.3]heptan-1-amine |
| SMILES | CCOC1CC(N[C@@H](C)c2ccncc2)C12CCC2 |
| InChI | InChI=1S/C16H24N2O/c1-3-19-15-11-14(16(15)7-4-8-16)18-12(2)13-5-9-17-10-6-13/h5-6,9-10,12,14-15,18H,3-4,7-8,11H2,1-2H3/t12-,14?,15?/m0/s1 |
| InChIKey | PUKWAYDXSVUILL-GRTSSRMGSA-N |
| XLogP | 3.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |