C10H14N2O3 — CID 81406872
2-hydroxyethyl N-[(1R)-1-pyridin-2-ylethyl]carbamate (PubChem CID 81406872) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-hydroxyethyl N-[(1R)-1-pyridin-2-ylethyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[(1R)-1-pyridin-2-ylethyl]carbamate |
|---|---|
| PubChem CID | 81406872 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-hydroxyethyl N-[(1R)-1-pyridin-2-ylethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OCCO)c1ccccn1 |
| InChI | InChI=1S/C10H14N2O3/c1-8(9-4-2-3-5-11-9)12-10(14)15-7-6-13/h2-5,8,13H,6-7H2,1H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | ODYQPDCHJQZUPU-MRVPVSSYSA-N |
| XLogP | 0.86 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |