C15H18N2OS — CID 81408213
3-amino-3-phenyl-N-[(1S)-1-thiophen-2-ylethyl]propanamide (PubChem CID 81408213) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-amino-3-phenyl-N-[(1S)-1-thiophen-2-ylethyl]propanamide.
| Compound Name | 3-amino-3-phenyl-N-[(1S)-1-thiophen-2-ylethyl]propanamide |
|---|---|
| PubChem CID | 81408213 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-amino-3-phenyl-N-[(1S)-1-thiophen-2-ylethyl]propanamide |
| SMILES | C[C@H](NC(=O)CC(N)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C15H18N2OS/c1-11(14-8-5-9-19-14)17-15(18)10-13(16)12-6-3-2-4-7-12/h2-9,11,13H,10,16H2,1H3,(H,17,18)/t11-,13?/m0/s1 |
| InChIKey | CRHCNUFSDTWGJL-AMGKYWFPSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |