C12H13N3O2S — CID 81409659
2-amino-6-ethoxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 81409659) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-amino-6-ethoxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-amino-6-ethoxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 81409659 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-amino-6-ethoxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCOc1cccc(N)c1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-17-9-5-3-4-8(13)10(9)11(16)15-12-14-6-7-18-12/h3-7H,2,13H2,1H3,(H,14,15,16) |
| InChIKey | CTABITNOAYQMLI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|