About 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol
3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol (PubChem CID 81411163) has the molecular formula C10H21NO3S
and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol |
| PubChem CID | 81411163 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CNCC1CCCS1(=O)=O |
| InChI | InChI=1S/C10H21NO3S/c1-10(2,8-12)7-11-6-9-4-3-5-15(9,13)14/h9,11-12H,3-8H2,1-2H3 |
| InChIKey | BYQWEDWAOGTHDO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol (CID 81411163) is 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol is CC(C)(CO)CNCC1CCCS1(=O)=O.
What is the InChIKey of 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol?
The InChIKey is BYQWEDWAOGTHDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3S/c1-10(2,8-12)7-11-6-9-4-3-5-15(9,13)14/h9,11-12H,3-8H2,1-2H3.
What are the key properties of 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol?
3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol has a molecular weight of 235.35 g/mol, XLogP of 0.17, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 81411163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).