C15H30N2O — CID 81411194
[1-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]cyclohexyl]methanol (PubChem CID 81411194) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is [1-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 81411194 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | [1-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]cyclohexyl]methanol |
| SMILES | CCN1CCCC1CNCC1(CO)CCCCC1 |
| InChI | InChI=1S/C15H30N2O/c1-2-17-10-6-7-14(17)11-16-12-15(13-18)8-4-3-5-9-15/h14,16,18H,2-13H2,1H3 |
| InChIKey | CKRNXNCUJPJPJL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |