About 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol
3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol (PubChem CID 81411774) has the molecular formula C14H22FNO
and a molecular weight of 239.33 g/mol. Its IUPAC name is 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol |
| PubChem CID | 81411774 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol |
| SMILES | Cc1cc(CNCC(C)(C)CO)cc(C)c1F |
| InChI | InChI=1S/C14H22FNO/c1-10-5-12(6-11(2)13(10)15)7-16-8-14(3,4)9-17/h5-6,16-17H,7-9H2,1-4H3 |
| InChIKey | YFPUHKVOJGQKSF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol (CID 81411774) is 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol is Cc1cc(CNCC(C)(C)CO)cc(C)c1F.
What is the InChIKey of 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol?
The InChIKey is YFPUHKVOJGQKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FNO/c1-10-5-12(6-11(2)13(10)15)7-16-8-14(3,4)9-17/h5-6,16-17H,7-9H2,1-4H3.
What are the key properties of 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol?
3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol has a molecular weight of 239.33 g/mol, XLogP of 2.55, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-fluoro-3,5-dimethylphenyl)methylamino]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 81411774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).