About 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol
2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol (PubChem CID 81413030) has the molecular formula C12H25NO3S
and a molecular weight of 263.40 g/mol. Its IUPAC name is 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol.
Molecular Properties
| Compound Name | 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol |
| PubChem CID | 81413030 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)CNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H25NO3S/c1-3-12(4-2,10-14)9-13-11-5-7-17(15,16)8-6-11/h11,13-14H,3-10H2,1-2H3 |
| InChIKey | NVWQJKHHAMHWNB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol?
The IUPAC name of 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol (CID 81413030) is 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol.
What is the SMILES notation for 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol?
The canonical SMILES for 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol is CCC(CC)(CO)CNC1CCS(=O)(=O)CC1.
What is the InChIKey of 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol?
The InChIKey is NVWQJKHHAMHWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3S/c1-3-12(4-2,10-14)9-13-11-5-7-17(15,16)8-6-11/h11,13-14H,3-10H2,1-2H3.
What are the key properties of 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol?
2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol has a molecular weight of 263.40 g/mol, XLogP of 0.95, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1,1-dioxothian-4-yl)amino]methyl]-2-ethylbutan-1-ol is sourced from PubChem (CID 81413030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).