C14H20N2O4 — CID 81414134
[1-(ethylamino)-1-oxopropan-2-yl] 2-amino-6-ethoxybenzoate (PubChem CID 81414134) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [1-(ethylamino)-1-oxopropan-2-yl] 2-amino-6-ethoxybenzoate.
| Compound Name | [1-(ethylamino)-1-oxopropan-2-yl] 2-amino-6-ethoxybenzoate |
|---|---|
| PubChem CID | 81414134 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [1-(ethylamino)-1-oxopropan-2-yl] 2-amino-6-ethoxybenzoate |
| SMILES | CCNC(=O)C(C)OC(=O)c1c(N)cccc1OCC |
| InChI | InChI=1S/C14H20N2O4/c1-4-16-13(17)9(3)20-14(18)12-10(15)7-6-8-11(12)19-5-2/h6-9H,4-5,15H2,1-3H3,(H,16,17) |
| InChIKey | SHXIQJLJDTZKOP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|