About 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine
3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine (PubChem CID 81415528) has the molecular formula C12H16BrN
and a molecular weight of 254.17 g/mol. Its IUPAC name is 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine |
| PubChem CID | 81415528 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine |
| SMILES | CC1(C)C(N)CC1c1ccccc1Br |
| InChI | InChI=1S/C12H16BrN/c1-12(2)9(7-11(12)14)8-5-3-4-6-10(8)13/h3-6,9,11H,7,14H2,1-2H3 |
| InChIKey | OSSWQAJZKFHSGC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine?
The IUPAC name of 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine (CID 81415528) is 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine.
What is the SMILES notation for 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine?
The canonical SMILES for 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine is CC1(C)C(N)CC1c1ccccc1Br.
What is the InChIKey of 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine?
The InChIKey is OSSWQAJZKFHSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrN/c1-12(2)9(7-11(12)14)8-5-3-4-6-10(8)13/h3-6,9,11H,7,14H2,1-2H3.
What are the key properties of 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine?
3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine has a molecular weight of 254.17 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromophenyl)-2,2-dimethylcyclobutan-1-amine is sourced from PubChem (CID 81415528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).