C13H17Cl2N — CID 81418328
3-(2,4-dichlorophenyl)-N,2,2-trimethylcyclobutan-1-amine (PubChem CID 81418328) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N,2,2-trimethylcyclobutan-1-amine.
| Compound Name | 3-(2,4-dichlorophenyl)-N,2,2-trimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 81418328 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N,2,2-trimethylcyclobutan-1-amine |
| SMILES | CNC1CC(c2ccc(Cl)cc2Cl)C1(C)C |
| InChI | InChI=1S/C13H17Cl2N/c1-13(2)10(7-12(13)16-3)9-5-4-8(14)6-11(9)15/h4-6,10,12,16H,7H2,1-3H3 |
| InChIKey | LNAVENFBLZNMOX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |