About [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol
[1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol (PubChem CID 81418866) has the molecular formula C12H21NO3S
and a molecular weight of 259.37 g/mol. Its IUPAC name is [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol |
| PubChem CID | 81418866 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol |
| SMILES | O=S1(=O)C=CC(NCC2(CO)CCCCC2)C1 |
| InChI | InChI=1S/C12H21NO3S/c14-10-12(5-2-1-3-6-12)9-13-11-4-7-17(15,16)8-11/h4,7,11,13-14H,1-3,5-6,8-10H2 |
| InChIKey | TWHRCOKYXNWDOZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol?
The IUPAC name of [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol (CID 81418866) is [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol.
What is the SMILES notation for [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol?
The canonical SMILES for [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol is O=S1(=O)C=CC(NCC2(CO)CCCCC2)C1.
What is the InChIKey of [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol?
The InChIKey is TWHRCOKYXNWDOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3S/c14-10-12(5-2-1-3-6-12)9-13-11-4-7-17(15,16)8-11/h4,7,11,13-14H,1-3,5-6,8-10H2.
What are the key properties of [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol?
[1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol has a molecular weight of 259.37 g/mol, XLogP of 0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]cyclohexyl]methanol is sourced from PubChem (CID 81418866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).