About 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol
2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol (PubChem CID 81419405) has the molecular formula C14H27F3N2O
and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol |
| PubChem CID | 81419405 |
| Molecular Formula | C14H27F3N2O |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H27F3N2O/c1-3-13(4-2,11-20)9-18-7-12-5-6-19(8-12)10-14(15,16)17/h12,18,20H,3-11H2,1-2H3 |
| InChIKey | DTKVHQCAYRSVFK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol?
The IUPAC name of 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol (CID 81419405) is 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol.
What is the SMILES notation for 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol?
The canonical SMILES for 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol is CCC(CC)(CO)CNCC1CCN(CC(F)(F)F)C1.
What is the InChIKey of 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol?
The InChIKey is DTKVHQCAYRSVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27F3N2O/c1-3-13(4-2,11-20)9-18-7-12-5-6-19(8-12)10-14(15,16)17/h12,18,20H,3-11H2,1-2H3.
What are the key properties of 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol?
2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol has a molecular weight of 296.38 g/mol, XLogP of 2.26, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]methyl]butan-1-ol is sourced from PubChem (CID 81419405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).